C21H26FN3O — CID 91952386
azepan-1-yl-[1-(6-fluoroquinolin-4-yl)piperidin-4-yl]methanone (PubChem CID 91952386) has the molecular formula C21H26FN3O and a molecular weight of 355.46 g/mol. Its IUPAC name is azepan-1-yl-[1-(6-fluoroquinolin-4-yl)piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-(6-fluoroquinolin-4-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 91952386 |
| Molecular Formula | C21H26FN3O |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | azepan-1-yl-[1-(6-fluoroquinolin-4-yl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2ccnc3ccc(F)cc23)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C21H26FN3O/c22-17-5-6-19-18(15-17)20(7-10-23-19)24-13-8-16(9-14-24)21(26)25-11-3-1-2-4-12-25/h5-7,10,15-16H,1-4,8-9,11-14H2 |
| InChIKey | CNWATUDXTDNIFX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |