C24H29FN4O3 — CID 91952391
[1-(6-fluoroquinolin-4-yl)piperidin-4-yl]-[4-(oxolane-2-carbonyl)piperazin-1-yl]methanone (PubChem CID 91952391) has the molecular formula C24H29FN4O3 and a molecular weight of 440.52 g/mol. Its IUPAC name is [1-(6-fluoroquinolin-4-yl)piperidin-4-yl]-[4-(oxolane-2-carbonyl)piperazin-1-yl]methanone.
| Compound Name | [1-(6-fluoroquinolin-4-yl)piperidin-4-yl]-[4-(oxolane-2-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 91952391 |
| Molecular Formula | C24H29FN4O3 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [1-(6-fluoroquinolin-4-yl)piperidin-4-yl]-[4-(oxolane-2-carbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CCN(c2ccnc3ccc(F)cc23)CC1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C24H29FN4O3/c25-18-3-4-20-19(16-18)21(5-8-26-20)27-9-6-17(7-10-27)23(30)28-11-13-29(14-12-28)24(31)22-2-1-15-32-22/h3-5,8,16-17,22H,1-2,6-7,9-15H2 |
| InChIKey | FXJRIEWHVMULDX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |