C26H28FN5O — CID 91952366
1-(6-fluoroquinolin-4-yl)-N-[3-(3-methylindazol-1-yl)propyl]piperidine-4-carboxamide (PubChem CID 91952366) has the molecular formula C26H28FN5O and a molecular weight of 445.54 g/mol. Its IUPAC name is 1-(6-fluoroquinolin-4-yl)-N-[3-(3-methylindazol-1-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(6-fluoroquinolin-4-yl)-N-[3-(3-methylindazol-1-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 91952366 |
| Molecular Formula | C26H28FN5O |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 1-(6-fluoroquinolin-4-yl)-N-[3-(3-methylindazol-1-yl)propyl]piperidine-4-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)C2CCN(c3ccnc4ccc(F)cc34)CC2)c2ccccc12 |
| InChI | InChI=1S/C26H28FN5O/c1-18-21-5-2-3-6-25(21)32(30-18)14-4-12-29-26(33)19-10-15-31(16-11-19)24-9-13-28-23-8-7-20(27)17-22(23)24/h2-3,5-9,13,17,19H,4,10-12,14-16H2,1H3,(H,29,33) |
| InChIKey | VCJDMOFLOQTSEL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|