C25H26ClFN2O — CID 162228825
1-(4-chlorophenyl)-4-[1-(6-fluoroquinolin-4-yl)piperidin-4-yl]pentan-2-one (PubChem CID 162228825) has the molecular formula C25H26ClFN2O and a molecular weight of 424.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[1-(6-fluoroquinolin-4-yl)piperidin-4-yl]pentan-2-one.
| Compound Name | 1-(4-chlorophenyl)-4-[1-(6-fluoroquinolin-4-yl)piperidin-4-yl]pentan-2-one |
|---|---|
| PubChem CID | 162228825 |
| Molecular Formula | C25H26ClFN2O |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[1-(6-fluoroquinolin-4-yl)piperidin-4-yl]pentan-2-one |
| SMILES | CC(CC(=O)Cc1ccc(Cl)cc1)C1CCN(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C25H26ClFN2O/c1-17(14-22(30)15-18-2-4-20(26)5-3-18)19-9-12-29(13-10-19)25-8-11-28-24-7-6-21(27)16-23(24)25/h2-8,11,16-17,19H,9-10,12-15H2,1H3 |
| InChIKey | ZVDAYMWNZKAXHQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |