C19H27FN2O2 — CID 147207500
4-[1-[(2S)-2-aminopropanoyl]piperidin-4-yl]-1-(4-fluorophenyl)pentan-2-one (PubChem CID 147207500) has the molecular formula C19H27FN2O2 and a molecular weight of 334.44 g/mol. Its IUPAC name is 4-[1-[(2S)-2-aminopropanoyl]piperidin-4-yl]-1-(4-fluorophenyl)pentan-2-one.
| Compound Name | 4-[1-[(2S)-2-aminopropanoyl]piperidin-4-yl]-1-(4-fluorophenyl)pentan-2-one |
|---|---|
| PubChem CID | 147207500 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 4-[1-[(2S)-2-aminopropanoyl]piperidin-4-yl]-1-(4-fluorophenyl)pentan-2-one |
| SMILES | CC(CC(=O)Cc1ccc(F)cc1)C1CCN(C(=O)[C@H](C)N)CC1 |
| InChI | InChI=1S/C19H27FN2O2/c1-13(11-18(23)12-15-3-5-17(20)6-4-15)16-7-9-22(10-8-16)19(24)14(2)21/h3-6,13-14,16H,7-12,21H2,1-2H3/t13?,14-/m0/s1 |
| InChIKey | CEODGFZMLGMRJK-KZUDCZAMSA-N |
| XLogP | 2.55 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |