About 1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane
1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane (PubChem CID 166682867) has the molecular formula C15H13FN2O
and a molecular weight of 256.28 g/mol. Its IUPAC name is 1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane.
Molecular Properties
| Compound Name | 1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane |
| PubChem CID | 166682867 |
| Molecular Formula | C15H13FN2O |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane |
| SMILES | Fc1ccc2nccc(OCC34C5CNC3C54)c2c1 |
| InChI | InChI=1S/C15H13FN2O/c16-8-1-2-11-9(5-8)12(3-4-17-11)19-7-15-10-6-18-14(15)13(10)15/h1-5,10,13-14,18H,6-7H2 |
| InChIKey | SPBRRNIDIQUWBD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane?
The IUPAC name of 1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane (CID 166682867) is 1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane.
What is the SMILES notation for 1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane?
The canonical SMILES for 1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane is Fc1ccc2nccc(OCC34C5CNC3C54)c2c1.
What is the InChIKey of 1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane?
The InChIKey is SPBRRNIDIQUWBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FN2O/c16-8-1-2-11-9(5-8)12(3-4-17-11)19-7-15-10-6-18-14(15)13(10)15/h1-5,10,13-14,18H,6-7H2.
What are the key properties of 1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane?
1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane has a molecular weight of 256.28 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-fluoroquinolin-4-yl)oxymethyl]-3-azatricyclo[3.1.0.02,6]hexane is sourced from PubChem (CID 166682867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).