C23H24FN3O2 — CID 146318438
N-(3-amino-1-bicyclo[1.1.1]pentanyl)-2-[(3R,5S,6R)-3-(6-fluoroquinolin-4-yl)oxy-6-bicyclo[3.1.0]hex-1-enyl]propanamide (PubChem CID 146318438) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is N-(3-amino-1-bicyclo[1.1.1]pentanyl)-2-[(3R,5S,6R)-3-(6-fluoroquinolin-4-yl)oxy-6-bicyclo[3.1.0]hex-1-enyl]propanamide.
| Compound Name | N-(3-amino-1-bicyclo[1.1.1]pentanyl)-2-[(3R,5S,6R)-3-(6-fluoroquinolin-4-yl)oxy-6-bicyclo[3.1.0]hex-1-enyl]propanamide |
|---|---|
| PubChem CID | 146318438 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-(3-amino-1-bicyclo[1.1.1]pentanyl)-2-[(3R,5S,6R)-3-(6-fluoroquinolin-4-yl)oxy-6-bicyclo[3.1.0]hex-1-enyl]propanamide |
| SMILES | CC(C(=O)NC12CC(N)(C1)C2)[C@@H]1C2=C[C@H](Oc3ccnc4ccc(F)cc34)C[C@H]21 |
| InChI | InChI=1S/C23H24FN3O2/c1-12(21(28)27-23-9-22(25,10-23)11-23)20-15-7-14(8-16(15)20)29-19-4-5-26-18-3-2-13(24)6-17(18)19/h2-7,12,14,16,20H,8-11,25H2,1H3,(H,27,28)/t12?,14-,16+,20+,22?,23?/m0/s1 |
| InChIKey | BFVULJMDJIMLAW-QZHXNTBCSA-N |
| XLogP | 3.08 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|