C21H24FNO2 — CID 155016560
methyl (2R)-2-[(3aS)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]propanoate (PubChem CID 155016560) has the molecular formula C21H24FNO2 and a molecular weight of 341.43 g/mol. Its IUPAC name is methyl (2R)-2-[(3aS)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]propanoate.
| Compound Name | methyl (2R)-2-[(3aS)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]propanoate |
|---|---|
| PubChem CID | 155016560 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | methyl (2R)-2-[(3aS)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]propanoate |
| SMILES | COC(=O)[C@H](C)C1CC2CC(c3ccnc4ccc(F)cc34)C[C@@H]2C1 |
| InChI | InChI=1S/C21H24FNO2/c1-12(21(24)25-2)13-7-14-9-16(10-15(14)8-13)18-5-6-23-20-4-3-17(22)11-19(18)20/h3-6,11-16H,7-10H2,1-2H3/t12-,13?,14+,15?,16?/m1/s1 |
| InChIKey | PELLYKKZIPAKGI-QWTWQCHQSA-N |
| XLogP | 4.70 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |