C20H23FN2O2 — CID 155016366
[(3aR)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl] N-ethylcarbamate (PubChem CID 155016366) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is [(3aR)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl] N-ethylcarbamate.
| Compound Name | [(3aR)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 155016366 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [(3aR)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)OC1CC2CC(c3ccnc4ccc(F)cc34)C[C@@H]2C1 |
| InChI | InChI=1S/C20H23FN2O2/c1-2-22-20(24)25-16-9-12-7-14(8-13(12)10-16)17-5-6-23-19-4-3-15(21)11-18(17)19/h3-6,11-14,16H,2,7-10H2,1H3,(H,22,24)/t12-,13?,14?,16?/m1/s1 |
| InChIKey | CHPKHAZIMJWHBG-BHTBLZRRSA-N |
| XLogP | 4.39 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |