C24H32N4O4 — CID 146319013
2-[4-(2-amino-2-cyclohexylacetyl)piperazine-1-carbonyl]-6-methoxy-1-methylindole-3-carbaldehyde (PubChem CID 146319013) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-[4-(2-amino-2-cyclohexylacetyl)piperazine-1-carbonyl]-6-methoxy-1-methylindole-3-carbaldehyde.
| Compound Name | 2-[4-(2-amino-2-cyclohexylacetyl)piperazine-1-carbonyl]-6-methoxy-1-methylindole-3-carbaldehyde |
|---|---|
| PubChem CID | 146319013 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 2-[4-(2-amino-2-cyclohexylacetyl)piperazine-1-carbonyl]-6-methoxy-1-methylindole-3-carbaldehyde |
| SMILES | COc1ccc2c(C=O)c(C(=O)N3CCN(C(=O)C(N)C4CCCCC4)CC3)n(C)c2c1 |
| InChI | InChI=1S/C24H32N4O4/c1-26-20-14-17(32-2)8-9-18(20)19(15-29)22(26)24(31)28-12-10-27(11-13-28)23(30)21(25)16-6-4-3-5-7-16/h8-9,14-16,21H,3-7,10-13,25H2,1-2H3 |
| InChIKey | XZVUTIKYWVAJLK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|