C16H20FN3O3S — CID 146320579
2-(fluoromethyl)-7-N-methyl-5-N-(1-methylsulfanylazetidin-3-yl)-2,3-dihydro-1-benzofuran-5,7-dicarboxamide (PubChem CID 146320579) has the molecular formula C16H20FN3O3S and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-(fluoromethyl)-7-N-methyl-5-N-(1-methylsulfanylazetidin-3-yl)-2,3-dihydro-1-benzofuran-5,7-dicarboxamide.
| Compound Name | 2-(fluoromethyl)-7-N-methyl-5-N-(1-methylsulfanylazetidin-3-yl)-2,3-dihydro-1-benzofuran-5,7-dicarboxamide |
|---|---|
| PubChem CID | 146320579 |
| Molecular Formula | C16H20FN3O3S |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 2-(fluoromethyl)-7-N-methyl-5-N-(1-methylsulfanylazetidin-3-yl)-2,3-dihydro-1-benzofuran-5,7-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NC2CN(SC)C2)cc2c1OC(CF)C2 |
| InChI | InChI=1S/C16H20FN3O3S/c1-18-16(22)13-5-10(3-9-4-12(6-17)23-14(9)13)15(21)19-11-7-20(8-11)24-2/h3,5,11-12H,4,6-8H2,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | QQWZPKVYEIWRPV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|