C24H29FN2O4 — CID 138655139
(2R,3R)-2-(fluoromethyl)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-N-[(1S,2R)-2-(2-hydroxyethyl)cyclopropyl]-7-N-methyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide (PubChem CID 138655139) has the molecular formula C24H29FN2O4 and a molecular weight of 428.50 g/mol. Its IUPAC name is (2R,3R)-2-(fluoromethyl)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-N-[(1S,2R)-2-(2-hydroxyethyl)cyclopropyl]-7-N-methyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide.
| Compound Name | (2R,3R)-2-(fluoromethyl)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-N-[(1S,2R)-2-(2-hydroxyethyl)cyclopropyl]-7-N-methyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide |
|---|---|
| PubChem CID | 138655139 |
| Molecular Formula | C24H29FN2O4 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (2R,3R)-2-(fluoromethyl)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-N-[(1S,2R)-2-(2-hydroxyethyl)cyclopropyl]-7-N-methyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide |
| SMILES | C=C(/C=C\C=C/C)[C@@H]1c2cc(C(=O)N[C@H]3C[C@@H]3CCO)cc(C(=O)NC)c2O[C@H]1CF |
| InChI | InChI=1S/C24H29FN2O4/c1-4-5-6-7-14(2)21-17-10-16(23(29)27-19-12-15(19)8-9-28)11-18(24(30)26-3)22(17)31-20(21)13-25/h4-7,10-11,15,19-21,28H,2,8-9,12-13H2,1,3H3,(H,26,30)(H,27,29)/b5-4-,7-6-/t15-,19-,20-,21+/m0/s1 |
| InChIKey | QELLWTUNXKAAGU-PQLXUYTHSA-N |
| XLogP | 3.05 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|