C25H29FN2O5S — CID 131987326
5-N-[2-(2,2-dihydroxythian-4-yl)ethyl]-2-(fluoromethyl)-7-N-methyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide (PubChem CID 131987326) has the molecular formula C25H29FN2O5S and a molecular weight of 488.58 g/mol. Its IUPAC name is 5-N-[2-(2,2-dihydroxythian-4-yl)ethyl]-2-(fluoromethyl)-7-N-methyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide.
| Compound Name | 5-N-[2-(2,2-dihydroxythian-4-yl)ethyl]-2-(fluoromethyl)-7-N-methyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide |
|---|---|
| PubChem CID | 131987326 |
| Molecular Formula | C25H29FN2O5S |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 5-N-[2-(2,2-dihydroxythian-4-yl)ethyl]-2-(fluoromethyl)-7-N-methyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NCCC2CCSC(O)(O)C2)cc2c1OC(CF)C2c1ccccc1 |
| InChI | InChI=1S/C25H29FN2O5S/c1-27-24(30)19-12-17(23(29)28-9-7-15-8-10-34-25(31,32)13-15)11-18-21(16-5-3-2-4-6-16)20(14-26)33-22(18)19/h2-6,11-12,15,20-21,31-32H,7-10,13-14H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | XAGOGHBUUMYLIZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|