C26H33N3O3 — CID 131987122
(2R,3S)-7-N,2-dimethyl-3-phenyl-5-N-(3-piperidin-4-ylpropyl)-2,3-dihydro-1-benzofuran-5,7-dicarboxamide (PubChem CID 131987122) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is (2R,3S)-7-N,2-dimethyl-3-phenyl-5-N-(3-piperidin-4-ylpropyl)-2,3-dihydro-1-benzofuran-5,7-dicarboxamide.
| Compound Name | (2R,3S)-7-N,2-dimethyl-3-phenyl-5-N-(3-piperidin-4-ylpropyl)-2,3-dihydro-1-benzofuran-5,7-dicarboxamide |
|---|---|
| PubChem CID | 131987122 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | (2R,3S)-7-N,2-dimethyl-3-phenyl-5-N-(3-piperidin-4-ylpropyl)-2,3-dihydro-1-benzofuran-5,7-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NCCCC2CCNCC2)cc2c1O[C@H](C)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C26H33N3O3/c1-17-23(19-8-4-3-5-9-19)21-15-20(16-22(24(21)32-17)26(31)27-2)25(30)29-12-6-7-18-10-13-28-14-11-18/h3-5,8-9,15-18,23,28H,6-7,10-14H2,1-2H3,(H,27,31)(H,29,30)/t17-,23+/m1/s1 |
| InChIKey | ZNFFXFBMYHSAAB-HXOBKFHXSA-N |
| XLogP | 3.47 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|