C25H29F2N3O3 — CID 131987196
(2R,3S)-5-N-[2-(4,4-difluoropiperidin-3-yl)ethyl]-7-N,2-dimethyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide (PubChem CID 131987196) has the molecular formula C25H29F2N3O3 and a molecular weight of 457.52 g/mol. Its IUPAC name is (2R,3S)-5-N-[2-(4,4-difluoropiperidin-3-yl)ethyl]-7-N,2-dimethyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide.
| Compound Name | (2R,3S)-5-N-[2-(4,4-difluoropiperidin-3-yl)ethyl]-7-N,2-dimethyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide |
|---|---|
| PubChem CID | 131987196 |
| Molecular Formula | C25H29F2N3O3 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | (2R,3S)-5-N-[2-(4,4-difluoropiperidin-3-yl)ethyl]-7-N,2-dimethyl-3-phenyl-2,3-dihydro-1-benzofuran-5,7-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NCCC2CNCCC2(F)F)cc2c1O[C@H](C)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C25H29F2N3O3/c1-15-21(16-6-4-3-5-7-16)19-12-17(13-20(22(19)33-15)24(32)28-2)23(31)30-10-8-18-14-29-11-9-25(18,26)27/h3-7,12-13,15,18,21,29H,8-11,14H2,1-2H3,(H,28,32)(H,30,31)/t15-,18?,21+/m1/s1 |
| InChIKey | QAQBMZVMFVGRPZ-GLMQBPPQSA-N |
| XLogP | 3.32 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |