C14H23F3N2O — CID 146322488
N-(1-ethyl-4-methylpiperidin-4-yl)-1-(trifluoromethyl)cyclobutane-1-carboxamide (PubChem CID 146322488) has the molecular formula C14H23F3N2O and a molecular weight of 292.34 g/mol. Its IUPAC name is N-(1-ethyl-4-methylpiperidin-4-yl)-1-(trifluoromethyl)cyclobutane-1-carboxamide.
| Compound Name | N-(1-ethyl-4-methylpiperidin-4-yl)-1-(trifluoromethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 146322488 |
| Molecular Formula | C14H23F3N2O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-(1-ethyl-4-methylpiperidin-4-yl)-1-(trifluoromethyl)cyclobutane-1-carboxamide |
| SMILES | CCN1CCC(C)(NC(=O)C2(C(F)(F)F)CCC2)CC1 |
| InChI | InChI=1S/C14H23F3N2O/c1-3-19-9-7-12(2,8-10-19)18-11(20)13(5-4-6-13)14(15,16)17/h3-10H2,1-2H3,(H,18,20) |
| InChIKey | NALMERVDSPYWTG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |