C14H26F2N2O — CID 171406675
N,1-ditert-butyl-3,3-difluoropiperidine-4-carboxamide (PubChem CID 171406675) has the molecular formula C14H26F2N2O and a molecular weight of 276.37 g/mol. Its IUPAC name is N,1-ditert-butyl-3,3-difluoropiperidine-4-carboxamide.
| Compound Name | N,1-ditert-butyl-3,3-difluoropiperidine-4-carboxamide |
|---|---|
| PubChem CID | 171406675 |
| Molecular Formula | C14H26F2N2O |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | N,1-ditert-butyl-3,3-difluoropiperidine-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CCN(C(C)(C)C)CC1(F)F |
| InChI | InChI=1S/C14H26F2N2O/c1-12(2,3)17-11(19)10-7-8-18(13(4,5)6)9-14(10,15)16/h10H,7-9H2,1-6H3,(H,17,19) |
| InChIKey | UTWUSTUTCCMJOZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |