C16H12F2N6O2 — CID 146322675
N-[4-[(dicyanomethylideneamino)oxymethyl]phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide (PubChem CID 146322675) has the molecular formula C16H12F2N6O2 and a molecular weight of 358.31 g/mol. Its IUPAC name is N-[4-[(dicyanomethylideneamino)oxymethyl]phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[4-[(dicyanomethylideneamino)oxymethyl]phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 146322675 |
| Molecular Formula | C16H12F2N6O2 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-[4-[(dicyanomethylideneamino)oxymethyl]phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccc(CON=C(C#N)C#N)cc2)c(C(F)F)n1 |
| InChI | InChI=1S/C16H12F2N6O2/c1-24-8-13(14(22-24)15(17)18)16(25)21-11-4-2-10(3-5-11)9-26-23-12(6-19)7-20/h2-5,8,15H,9H2,1H3,(H,21,25) |
| InChIKey | JYBPGIJXSDDWIT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|