About [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate
[[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate (PubChem CID 174988628) has the molecular formula C15H15F2N3O3
and a molecular weight of 323.30 g/mol. Its IUPAC name is [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate.
Molecular Properties
| Compound Name | [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate |
| PubChem CID | 174988628 |
| Molecular Formula | C15H15F2N3O3 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)ONC(=O)c2cn(C)nc2C(F)F)cc1 |
| InChI | InChI=1S/C15H15F2N3O3/c1-3-9-4-6-10(7-5-9)15(22)23-19-14(21)11-8-20(2)18-12(11)13(16)17/h4-8,13H,3H2,1-2H3,(H,19,21) |
| InChIKey | NYPZYTHJYBNVEN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate?
The IUPAC name of [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate (CID 174988628) is [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate.
What is the SMILES notation for [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate?
The canonical SMILES for [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate is CCc1ccc(C(=O)ONC(=O)c2cn(C)nc2C(F)F)cc1.
What is the InChIKey of [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate?
The InChIKey is NYPZYTHJYBNVEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F2N3O3/c1-3-9-4-6-10(7-5-9)15(22)23-19-14(21)11-8-20(2)18-12(11)13(16)17/h4-8,13H,3H2,1-2H3,(H,19,21).
What are the key properties of [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate?
[[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate has a molecular weight of 323.30 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate is sourced from PubChem (CID 174988628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).