C15H15F2N3O3 — CID 174988628
[[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate (PubChem CID 174988628) has the molecular formula C15H15F2N3O3 and a molecular weight of 323.30 g/mol. Its IUPAC name is [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate.
| Compound Name | [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate |
|---|---|
| PubChem CID | 174988628 |
| Molecular Formula | C15H15F2N3O3 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | [[3-(difluoromethyl)-1-methylpyrazole-4-carbonyl]amino] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)ONC(=O)c2cn(C)nc2C(F)F)cc1 |
| InChI | InChI=1S/C15H15F2N3O3/c1-3-9-4-6-10(7-5-9)15(22)23-19-14(21)11-8-20(2)18-12(11)13(16)17/h4-8,13H,3H2,1-2H3,(H,19,21) |
| InChIKey | NYPZYTHJYBNVEN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|