C19H25F2N3O2 — CID 171661723
N-[2-butoxy-2-(4-methylphenyl)ethyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide (PubChem CID 171661723) has the molecular formula C19H25F2N3O2 and a molecular weight of 365.42 g/mol. Its IUPAC name is N-[2-butoxy-2-(4-methylphenyl)ethyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[2-butoxy-2-(4-methylphenyl)ethyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 171661723 |
| Molecular Formula | C19H25F2N3O2 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[2-butoxy-2-(4-methylphenyl)ethyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide |
| SMILES | CCCCOC(CNC(=O)c1cn(C)nc1C(F)F)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H25F2N3O2/c1-4-5-10-26-16(14-8-6-13(2)7-9-14)11-22-19(25)15-12-24(3)23-17(15)18(20)21/h6-9,12,16,18H,4-5,10-11H2,1-3H3,(H,22,25) |
| InChIKey | HBFIZTKZNBQYLX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|