C12H13F2N5O — CID 171682394
3-(difluoromethyl)-1-methyl-N-(1-pyrimidin-5-ylethyl)pyrazole-4-carboxamide (PubChem CID 171682394) has the molecular formula C12H13F2N5O and a molecular weight of 281.27 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-methyl-N-(1-pyrimidin-5-ylethyl)pyrazole-4-carboxamide.
| Compound Name | 3-(difluoromethyl)-1-methyl-N-(1-pyrimidin-5-ylethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 171682394 |
| Molecular Formula | C12H13F2N5O |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3-(difluoromethyl)-1-methyl-N-(1-pyrimidin-5-ylethyl)pyrazole-4-carboxamide |
| SMILES | CC(NC(=O)c1cn(C)nc1C(F)F)c1cncnc1 |
| InChI | InChI=1S/C12H13F2N5O/c1-7(8-3-15-6-16-4-8)17-12(20)9-5-19(2)18-10(9)11(13)14/h3-7,11H,1-2H3,(H,17,20) |
| InChIKey | OKKGWBXOFGBFII-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |