C22H33N5O11 — CID 146322772
2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[4-(2,5-dioxopyrrol-1-yl)butylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid (PubChem CID 146322772) has the molecular formula C22H33N5O11 and a molecular weight of 543.53 g/mol. Its IUPAC name is 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[4-(2,5-dioxopyrrol-1-yl)butylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[4-(2,5-dioxopyrrol-1-yl)butylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 146322772 |
| Molecular Formula | C22H33N5O11 |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[4-(2,5-dioxopyrrol-1-yl)butylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CCN(CC(=O)O)CC(=O)O)CC(=O)NCCCCN1C(=O)C=CC1=O)CC(=O)O |
| InChI | InChI=1S/C22H33N5O11/c28-16(23-5-1-2-6-27-17(29)3-4-18(27)30)11-24(7-9-25(12-19(31)32)13-20(33)34)8-10-26(14-21(35)36)15-22(37)38/h3-4H,1-2,5-15H2,(H,23,28)(H,31,32)(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | JDBALMQLIGONKQ-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 225.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|