C23H36N4O10 — CID 19693325
2-[2-[2-[bis(carboxymethyl)amino]ethyl-[7-(2,5-dioxopyrrol-1-yl)heptyl]amino]ethyl-(carboxymethyl)amino]acetic acid (PubChem CID 19693325) has the molecular formula C23H36N4O10 and a molecular weight of 528.56 g/mol. Its IUPAC name is 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[7-(2,5-dioxopyrrol-1-yl)heptyl]amino]ethyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[7-(2,5-dioxopyrrol-1-yl)heptyl]amino]ethyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 19693325 |
| Molecular Formula | C23H36N4O10 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[7-(2,5-dioxopyrrol-1-yl)heptyl]amino]ethyl-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CCCCCCCN1C(=O)C=CC1=O)CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C23H36N4O10/c28-18-6-7-19(29)27(18)9-5-3-1-2-4-8-24(10-12-25(14-20(30)31)15-21(32)33)11-13-26(16-22(34)35)17-23(36)37/h6-7H,1-5,8-17H2,(H,30,31)(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | KUCDQZOKPNQNCK-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 196.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|