C24H37N5O11 — CID 146308028
2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-[6-(2,5-dioxopyrrol-1-yl)hexylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid (PubChem CID 146308028) has the molecular formula C24H37N5O11 and a molecular weight of 571.58 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-[6-(2,5-dioxopyrrol-1-yl)hexylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-[6-(2,5-dioxopyrrol-1-yl)hexylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 146308028 |
| Molecular Formula | C24H37N5O11 |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-[6-(2,5-dioxopyrrol-1-yl)hexylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)NCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C24H37N5O11/c30-18(25-7-3-1-2-4-8-29-19(31)5-6-20(29)32)13-27(15-22(35)36)11-9-26(14-21(33)34)10-12-28(16-23(37)38)17-24(39)40/h5-6H,1-4,7-17H2,(H,25,30)(H,33,34)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | OKVJWEUYRMAZMQ-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 225.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|