C21H33N3O6 — CID 90138498
2-[4-(carboxymethyl)-8-[4-(2,5-dioxopyrrol-1-yl)butyl]-1,4-diazacycloundec-1-yl]acetic acid (PubChem CID 90138498) has the molecular formula C21H33N3O6 and a molecular weight of 423.51 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-8-[4-(2,5-dioxopyrrol-1-yl)butyl]-1,4-diazacycloundec-1-yl]acetic acid.
| Compound Name | 2-[4-(carboxymethyl)-8-[4-(2,5-dioxopyrrol-1-yl)butyl]-1,4-diazacycloundec-1-yl]acetic acid |
|---|---|
| PubChem CID | 90138498 |
| Molecular Formula | C21H33N3O6 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 2-[4-(carboxymethyl)-8-[4-(2,5-dioxopyrrol-1-yl)butyl]-1,4-diazacycloundec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCC(CCCCN2C(=O)C=CC2=O)CCCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C21H33N3O6/c25-18-8-9-19(26)24(18)12-2-1-5-17-6-3-10-22(15-20(27)28)13-14-23(11-4-7-17)16-21(29)30/h8-9,17H,1-7,10-16H2,(H,27,28)(H,29,30) |
| InChIKey | IEVKWLHQFOKBGE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|