C18H28N4O6 — CID 67891266
2-[4-(carboxymethyl)-7-[4-(2,5-dioxopyrrol-1-yl)butyl]-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 67891266) has the molecular formula C18H28N4O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-7-[4-(2,5-dioxopyrrol-1-yl)butyl]-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-(carboxymethyl)-7-[4-(2,5-dioxopyrrol-1-yl)butyl]-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 67891266 |
| Molecular Formula | C18H28N4O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-[4-(carboxymethyl)-7-[4-(2,5-dioxopyrrol-1-yl)butyl]-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CCCCN2C(=O)C=CC2=O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C18H28N4O6/c23-15-3-4-16(24)22(15)6-2-1-5-19-7-9-20(13-17(25)26)11-12-21(10-8-19)14-18(27)28/h3-4H,1-2,5-14H2,(H,25,26)(H,27,28) |
| InChIKey | QZVZTNKPXBCVSO-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|