C14H15N3O6 — CID 146425686
2-[bis[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetic acid (PubChem CID 146425686) has the molecular formula C14H15N3O6 and a molecular weight of 321.29 g/mol. Its IUPAC name is 2-[bis[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 146425686 |
| Molecular Formula | C14H15N3O6 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-[bis[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN1C(=O)C=CC1=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H15N3O6/c18-10-1-2-11(19)16(10)7-5-15(9-14(22)23)6-8-17-12(20)3-4-13(17)21/h1-4H,5-9H2,(H,22,23) |
| InChIKey | PSTLMHSFLGLNSF-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|