C9H12N2O4 — CID 57112487
2-(2,5-dioxopyrrol-1-yl)ethyl-ethylcarbamic acid (PubChem CID 57112487) has the molecular formula C9H12N2O4 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)ethyl-ethylcarbamic acid.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)ethyl-ethylcarbamic acid |
|---|---|
| PubChem CID | 57112487 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)ethyl-ethylcarbamic acid |
| SMILES | CCN(CCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C9H12N2O4/c1-2-10(9(14)15)5-6-11-7(12)3-4-8(11)13/h3-4H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | NKCCTONIANMQTQ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|