C21H33N5O7 — CID 67891262
2-[4-(carboxymethyl)-7-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butyl]-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 67891262) has the molecular formula C21H33N5O7 and a molecular weight of 467.52 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-7-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butyl]-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-(carboxymethyl)-7-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butyl]-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 67891262 |
| Molecular Formula | C21H33N5O7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 2-[4-(carboxymethyl)-7-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butyl]-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CCCCNC(=O)CCN2C(=O)C=CC2=O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C21H33N5O7/c27-17(5-8-26-18(28)3-4-19(26)29)22-6-1-2-7-23-9-11-24(15-20(30)31)13-14-25(12-10-23)16-21(32)33/h3-4H,1-2,5-16H2,(H,22,27)(H,30,31)(H,32,33) |
| InChIKey | RCVKTOGPJMOZGB-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 150.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|