C7H9F3N2O — CID 146323214
(2E)-4-amino-N-(2,2-difluoroethyl)-2-fluoropenta-2,4-dienamide (PubChem CID 146323214) has the molecular formula C7H9F3N2O and a molecular weight of 194.16 g/mol. Its IUPAC name is (2E)-4-amino-N-(2,2-difluoroethyl)-2-fluoropenta-2,4-dienamide.
| Compound Name | (2E)-4-amino-N-(2,2-difluoroethyl)-2-fluoropenta-2,4-dienamide |
|---|---|
| PubChem CID | 146323214 |
| Molecular Formula | C7H9F3N2O |
| Molecular Weight | 194.16 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | (2E)-4-amino-N-(2,2-difluoroethyl)-2-fluoropenta-2,4-dienamide |
| SMILES | C=C(N)/C=C(/F)C(=O)NCC(F)F |
| InChI | InChI=1S/C7H9F3N2O/c1-4(11)2-5(8)7(13)12-3-6(9)10/h2,6H,1,3,11H2,(H,12,13)/b5-2+ |
| InChIKey | VSJPTTTVJUIXBH-GORDUTHDSA-N |
| XLogP | 0.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|