C13H13ClN2O3S — CID 146323371
4-chloro-N-(1-ethyl-6-oxo-3-pyridinyl)-5-methoxythiophene-2-carboxamide (PubChem CID 146323371) has the molecular formula C13H13ClN2O3S and a molecular weight of 312.78 g/mol. Its IUPAC name is 4-chloro-N-(1-ethyl-6-oxo-3-pyridinyl)-5-methoxythiophene-2-carboxamide.
| Compound Name | 4-chloro-N-(1-ethyl-6-oxo-3-pyridinyl)-5-methoxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 146323371 |
| Molecular Formula | C13H13ClN2O3S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 4-chloro-N-(1-ethyl-6-oxo-3-pyridinyl)-5-methoxythiophene-2-carboxamide |
| SMILES | CCn1cc(NC(=O)c2cc(Cl)c(OC)s2)ccc1=O |
| InChI | InChI=1S/C13H13ClN2O3S/c1-3-16-7-8(4-5-11(16)17)15-12(18)10-6-9(14)13(19-2)20-10/h4-7H,3H2,1-2H3,(H,15,18) |
| InChIKey | YHZPUUHODAWNBZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |