C20H19ClN2O2S — CID 55804395
N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-4-ethyl-5-methylthiophene-2-carboxamide (PubChem CID 55804395) has the molecular formula C20H19ClN2O2S and a molecular weight of 386.90 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-4-ethyl-5-methylthiophene-2-carboxamide.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-4-ethyl-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55804395 |
| Molecular Formula | C20H19ClN2O2S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-4-ethyl-5-methylthiophene-2-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2ccc(=O)n(Cc3ccccc3Cl)c2)sc1C |
| InChI | InChI=1S/C20H19ClN2O2S/c1-3-14-10-18(26-13(14)2)20(25)22-16-8-9-19(24)23(12-16)11-15-6-4-5-7-17(15)21/h4-10,12H,3,11H2,1-2H3,(H,22,25) |
| InChIKey | WTEBAXAOJRBEEA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |