C18H20ClN3O4 — CID 47059053
ethyl N-[3-[[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]amino]-3-oxopropyl]carbamate (PubChem CID 47059053) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is ethyl N-[3-[[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]amino]-3-oxopropyl]carbamate.
| Compound Name | ethyl N-[3-[[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 47059053 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | ethyl N-[3-[[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]amino]-3-oxopropyl]carbamate |
| SMILES | CCOC(=O)NCCC(=O)Nc1ccc(=O)n(Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C18H20ClN3O4/c1-2-26-18(25)20-10-9-16(23)21-14-7-8-17(24)22(12-14)11-13-5-3-4-6-15(13)19/h3-8,12H,2,9-11H2,1H3,(H,20,25)(H,21,23) |
| InChIKey | KQBHSKRXVCYAKV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |