C24H24ClN3O4 — CID 55859296
benzyl N-[4-[[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]amino]-4-oxobutyl]carbamate (PubChem CID 55859296) has the molecular formula C24H24ClN3O4 and a molecular weight of 453.93 g/mol. Its IUPAC name is benzyl N-[4-[[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]amino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55859296 |
| Molecular Formula | C24H24ClN3O4 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | benzyl N-[4-[[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]amino]-4-oxobutyl]carbamate |
| SMILES | O=C(CCCNC(=O)OCc1ccccc1)Nc1ccc(=O)n(Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C24H24ClN3O4/c25-21-10-5-4-9-19(21)15-28-16-20(12-13-23(28)30)27-22(29)11-6-14-26-24(31)32-17-18-7-2-1-3-8-18/h1-5,7-10,12-13,16H,6,11,14-15,17H2,(H,26,31)(H,27,29) |
| InChIKey | ZTAHQMWDAHJIKZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|