C9H13Cl2N — CID 146323553
2,3-dichloro-1-ethyl-5-propan-2-ylpyrrole (PubChem CID 146323553) has the molecular formula C9H13Cl2N and a molecular weight of 206.12 g/mol. Its IUPAC name is 2,3-dichloro-1-ethyl-5-propan-2-ylpyrrole.
| Compound Name | 2,3-dichloro-1-ethyl-5-propan-2-ylpyrrole |
|---|---|
| PubChem CID | 146323553 |
| Molecular Formula | C9H13Cl2N |
| Molecular Weight | 206.12 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 2,3-dichloro-1-ethyl-5-propan-2-ylpyrrole |
| SMILES | CCn1c(C(C)C)cc(Cl)c1Cl |
| InChI | InChI=1S/C9H13Cl2N/c1-4-12-8(6(2)3)5-7(10)9(12)11/h5-6H,4H2,1-3H3 |
| InChIKey | YMQVZKMZAGPFNK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.12 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |