C13H11ClO2S — CID 146324619
5-[(2-methylphenyl)methylsulfanyl]furan-2-carbonyl chloride (PubChem CID 146324619) has the molecular formula C13H11ClO2S and a molecular weight of 266.75 g/mol. Its IUPAC name is 5-[(2-methylphenyl)methylsulfanyl]furan-2-carbonyl chloride.
| Compound Name | 5-[(2-methylphenyl)methylsulfanyl]furan-2-carbonyl chloride |
|---|---|
| PubChem CID | 146324619 |
| Molecular Formula | C13H11ClO2S |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 5-[(2-methylphenyl)methylsulfanyl]furan-2-carbonyl chloride |
| SMILES | Cc1ccccc1CSc1ccc(C(=O)Cl)o1 |
| InChI | InChI=1S/C13H11ClO2S/c1-9-4-2-3-5-10(9)8-17-12-7-6-11(16-12)13(14)15/h2-7H,8H2,1H3 |
| InChIKey | NICBWYGNYAQKQR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|