C28H29N3OS — CID 146324778
4-(4,4-dimethylpiperidin-1-yl)-N-[4-(1H-indol-2-yl)phenyl]sulfanylbenzamide (PubChem CID 146324778) has the molecular formula C28H29N3OS and a molecular weight of 455.63 g/mol. Its IUPAC name is 4-(4,4-dimethylpiperidin-1-yl)-N-[4-(1H-indol-2-yl)phenyl]sulfanylbenzamide.
| Compound Name | 4-(4,4-dimethylpiperidin-1-yl)-N-[4-(1H-indol-2-yl)phenyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 146324778 |
| Molecular Formula | C28H29N3OS |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 4-(4,4-dimethylpiperidin-1-yl)-N-[4-(1H-indol-2-yl)phenyl]sulfanylbenzamide |
| SMILES | CC1(C)CCN(c2ccc(C(=O)NSc3ccc(-c4cc5ccccc5[nH]4)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H29N3OS/c1-28(2)15-17-31(18-16-28)23-11-7-21(8-12-23)27(32)30-33-24-13-9-20(10-14-24)26-19-22-5-3-4-6-25(22)29-26/h3-14,19,29H,15-18H2,1-2H3,(H,30,32) |
| InChIKey | GMKAFCRIZZLWNH-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|