C24H20N2O4 — CID 168649817
dimethyl 1-[4-(1H-indol-2-yl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168649817) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is dimethyl 1-[4-(1H-indol-2-yl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-(1H-indol-2-yl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168649817 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | dimethyl 1-[4-(1H-indol-2-yl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(-c3cc4ccccc4[nH]3)cc2)C=CC=C1 |
| InChI | InChI=1S/C24H20N2O4/c1-29-23(27)19-8-5-6-14-26(22(19)24(28)30-2)18-12-10-16(11-13-18)21-15-17-7-3-4-9-20(17)25-21/h3-15,25H,1-2H3 |
| InChIKey | BEHDOXAGFMSULB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |