C23H26FNO3 — CID 146325722
3-fluoro-N-hydroxy-4-[4-(9-methyl-9-bicyclo[3.3.1]nonanyl)phenoxy]benzamide (PubChem CID 146325722) has the molecular formula C23H26FNO3 and a molecular weight of 383.46 g/mol. Its IUPAC name is 3-fluoro-N-hydroxy-4-[4-(9-methyl-9-bicyclo[3.3.1]nonanyl)phenoxy]benzamide.
| Compound Name | 3-fluoro-N-hydroxy-4-[4-(9-methyl-9-bicyclo[3.3.1]nonanyl)phenoxy]benzamide |
|---|---|
| PubChem CID | 146325722 |
| Molecular Formula | C23H26FNO3 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 3-fluoro-N-hydroxy-4-[4-(9-methyl-9-bicyclo[3.3.1]nonanyl)phenoxy]benzamide |
| SMILES | CC1(c2ccc(Oc3ccc(C(=O)NO)cc3F)cc2)C2CCCC1CCC2 |
| InChI | InChI=1S/C23H26FNO3/c1-23(16-4-2-5-17(23)7-3-6-16)18-9-11-19(12-10-18)28-21-13-8-15(14-20(21)24)22(26)25-27/h8-14,16-17,27H,2-7H2,1H3,(H,25,26) |
| InChIKey | QBNQAWYNKYCGNQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|