C29H30N4O — CID 146325879
(E)-5-(8-cyano-3-methylquinolin-6-yl)-N,4-dimethyl-2-methylidene-N-[(6-methyl-5-prop-1-en-2-yl-3-pyridinyl)methyl]pent-3-enamide (PubChem CID 146325879) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is (E)-5-(8-cyano-3-methylquinolin-6-yl)-N,4-dimethyl-2-methylidene-N-[(6-methyl-5-prop-1-en-2-yl-3-pyridinyl)methyl]pent-3-enamide.
| Compound Name | (E)-5-(8-cyano-3-methylquinolin-6-yl)-N,4-dimethyl-2-methylidene-N-[(6-methyl-5-prop-1-en-2-yl-3-pyridinyl)methyl]pent-3-enamide |
|---|---|
| PubChem CID | 146325879 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | (E)-5-(8-cyano-3-methylquinolin-6-yl)-N,4-dimethyl-2-methylidene-N-[(6-methyl-5-prop-1-en-2-yl-3-pyridinyl)methyl]pent-3-enamide |
| SMILES | C=C(/C=C(\C)Cc1cc(C#N)c2ncc(C)cc2c1)C(=O)N(C)Cc1cnc(C)c(C(=C)C)c1 |
| InChI | InChI=1S/C29H30N4O/c1-18(2)27-13-24(16-31-22(27)6)17-33(7)29(34)21(5)8-19(3)9-23-11-25-10-20(4)15-32-28(25)26(12-23)14-30/h8,10-13,15-16H,1,5,9,17H2,2-4,6-7H3/b19-8+ |
| InChIKey | XSCZEMDJPOCPMZ-UFWORHAWSA-N |
| XLogP | 5.86 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|