C31H29F2N9O4 — CID 146327697
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[2,3-difluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-2-phenylethanone (PubChem CID 146327697) has the molecular formula C31H29F2N9O4 and a molecular weight of 629.63 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[2,3-difluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-2-phenylethanone.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[2,3-difluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 146327697 |
| Molecular Formula | C31H29F2N9O4 |
| Molecular Weight | 629.63 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[2,3-difluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-2-phenylethanone |
| SMILES | COCCOc1ccc(N2CCN(C(=O)C(c3ccccc3)n3ncc4c3nc(N)n3nc(-c5ccco5)nc43)CC2)c(F)c1F |
| InChI | InChI=1S/C31H29F2N9O4/c1-44-16-17-46-22-10-9-21(24(32)25(22)33)39-11-13-40(14-12-39)30(43)26(19-6-3-2-4-7-19)41-29-20(18-35-41)28-36-27(23-8-5-15-45-23)38-42(28)31(34)37-29/h2-10,15,18,26H,11-14,16-17H2,1H3,(H2,34,37) |
| InChIKey | VWFVKEZKMUCUBM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|