C30H36N10O4 — CID 146328110
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-2-piperidin-4-ylethanone (PubChem CID 146328110) has the molecular formula C30H36N10O4 and a molecular weight of 600.68 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-2-piperidin-4-ylethanone.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-2-piperidin-4-ylethanone |
|---|---|
| PubChem CID | 146328110 |
| Molecular Formula | C30H36N10O4 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-2-piperidin-4-ylethanone |
| SMILES | COCCOc1ccc(N2CCN(C(=O)C(C3CCNCC3)n3ncc4c3nc(N)n3nc(-c5ccco5)nc43)CC2)cc1 |
| InChI | InChI=1S/C30H36N10O4/c1-42-17-18-43-22-6-4-21(5-7-22)37-12-14-38(15-13-37)29(41)25(20-8-10-32-11-9-20)39-28-23(19-33-39)27-34-26(24-3-2-16-44-24)36-40(27)30(31)35-28/h2-7,16,19-20,25,32H,8-15,17-18H2,1H3,(H2,31,35) |
| InChIKey | ZPQSJKAJNMCNGK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 154.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|