C20H20N4O8 — CID 146328389
2-[3-(3,4-dihydroxyphenyl)-5-(3,3-dihydroxypropanoyl)-1,2,4-triazol-1-yl]-N-[(3-hydroperoxyphenyl)methyl]acetamide (PubChem CID 146328389) has the molecular formula C20H20N4O8 and a molecular weight of 444.40 g/mol. Its IUPAC name is 2-[3-(3,4-dihydroxyphenyl)-5-(3,3-dihydroxypropanoyl)-1,2,4-triazol-1-yl]-N-[(3-hydroperoxyphenyl)methyl]acetamide.
| Compound Name | 2-[3-(3,4-dihydroxyphenyl)-5-(3,3-dihydroxypropanoyl)-1,2,4-triazol-1-yl]-N-[(3-hydroperoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 146328389 |
| Molecular Formula | C20H20N4O8 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 2-[3-(3,4-dihydroxyphenyl)-5-(3,3-dihydroxypropanoyl)-1,2,4-triazol-1-yl]-N-[(3-hydroperoxyphenyl)methyl]acetamide |
| SMILES | O=C(Cn1nc(-c2ccc(O)c(O)c2)nc1C(=O)CC(O)O)NCc1cccc(OO)c1 |
| InChI | InChI=1S/C20H20N4O8/c25-14-5-4-12(7-15(14)26)19-22-20(16(27)8-18(29)30)24(23-19)10-17(28)21-9-11-2-1-3-13(6-11)32-31/h1-7,18,25-26,29-31H,8-10H2,(H,21,28) |
| InChIKey | SWSXXCLWFKXOQF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|