About 7,10-dimethyl-3,4-dihydrobenzo[c]carbazole
7,10-dimethyl-3,4-dihydrobenzo[c]carbazole (PubChem CID 146329246) has the molecular formula C18H17N
and a molecular weight of 247.34 g/mol. Its IUPAC name is 7,10-dimethyl-3,4-dihydrobenzo[c]carbazole.
Molecular Properties
| Compound Name | 7,10-dimethyl-3,4-dihydrobenzo[c]carbazole |
| PubChem CID | 146329246 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 7,10-dimethyl-3,4-dihydrobenzo[c]carbazole |
| SMILES | Cc1ccc2c(c1)c1c3c(ccc1n2C)CCC=C3 |
| InChI | InChI=1S/C18H17N/c1-12-7-9-16-15(11-12)18-14-6-4-3-5-13(14)8-10-17(18)19(16)2/h4,6-11H,3,5H2,1-2H3 |
| InChIKey | AURXCEWQXHGIQG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7,10-dimethyl-3,4-dihydrobenzo[c]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,10-dimethyl-3,4-dihydrobenzo[c]carbazole?
The IUPAC name of 7,10-dimethyl-3,4-dihydrobenzo[c]carbazole (CID 146329246) is 7,10-dimethyl-3,4-dihydrobenzo[c]carbazole.
What is the SMILES notation for 7,10-dimethyl-3,4-dihydrobenzo[c]carbazole?
The canonical SMILES for 7,10-dimethyl-3,4-dihydrobenzo[c]carbazole is Cc1ccc2c(c1)c1c3c(ccc1n2C)CCC=C3.
What is the InChIKey of 7,10-dimethyl-3,4-dihydrobenzo[c]carbazole?
The InChIKey is AURXCEWQXHGIQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N/c1-12-7-9-16-15(11-12)18-14-6-4-3-5-13(14)8-10-17(18)19(16)2/h4,6-11H,3,5H2,1-2H3.
What are the key properties of 7,10-dimethyl-3,4-dihydrobenzo[c]carbazole?
7,10-dimethyl-3,4-dihydrobenzo[c]carbazole has a molecular weight of 247.34 g/mol, XLogP of 4.60, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,10-dimethyl-3,4-dihydrobenzo[c]carbazole is sourced from PubChem (CID 146329246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).