C18H24F3N3O2 — CID 146330154
N-[2-[4-[6-(trifluoromethyl)-2-pyridinyl]piperidin-1-yl]ethyl]oxolane-3-carboxamide (PubChem CID 146330154) has the molecular formula C18H24F3N3O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is N-[2-[4-[6-(trifluoromethyl)-2-pyridinyl]piperidin-1-yl]ethyl]oxolane-3-carboxamide.
| Compound Name | N-[2-[4-[6-(trifluoromethyl)-2-pyridinyl]piperidin-1-yl]ethyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 146330154 |
| Molecular Formula | C18H24F3N3O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[2-[4-[6-(trifluoromethyl)-2-pyridinyl]piperidin-1-yl]ethyl]oxolane-3-carboxamide |
| SMILES | O=C(NCCN1CCC(c2cccc(C(F)(F)F)n2)CC1)C1CCOC1 |
| InChI | InChI=1S/C18H24F3N3O2/c19-18(20,21)16-3-1-2-15(23-16)13-4-8-24(9-5-13)10-7-22-17(25)14-6-11-26-12-14/h1-3,13-14H,4-12H2,(H,22,25) |
| InChIKey | GGSIQDWKWRXJBY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |