C9H14F3NO3 — CID 86850738
N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide (PubChem CID 86850738) has the molecular formula C9H14F3NO3 and a molecular weight of 241.21 g/mol. Its IUPAC name is N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide.
| Compound Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 86850738 |
| Molecular Formula | C9H14F3NO3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-3-carboxamide |
| SMILES | O=C(NCCOCC(F)(F)F)C1CCOC1 |
| InChI | InChI=1S/C9H14F3NO3/c10-9(11,12)6-16-4-2-13-8(14)7-1-3-15-5-7/h7H,1-6H2,(H,13,14) |
| InChIKey | LXFIWHZHXXHHEQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|