C32H32N4O5 — CID 146331054
methyl 1-(1-anilino-2-phenylethyl)-3-[2-(phenylcarbamoylamino)ethylcarbamoyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate (PubChem CID 146331054) has the molecular formula C32H32N4O5 and a molecular weight of 552.63 g/mol. Its IUPAC name is methyl 1-(1-anilino-2-phenylethyl)-3-[2-(phenylcarbamoylamino)ethylcarbamoyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate.
| Compound Name | methyl 1-(1-anilino-2-phenylethyl)-3-[2-(phenylcarbamoylamino)ethylcarbamoyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
|---|---|
| PubChem CID | 146331054 |
| Molecular Formula | C32H32N4O5 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | methyl 1-(1-anilino-2-phenylethyl)-3-[2-(phenylcarbamoylamino)ethylcarbamoyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
| SMILES | COC(=O)C1=C(C(=O)NCCNC(=O)Nc2ccccc2)C2C=CC1(C(Cc1ccccc1)Nc1ccccc1)O2 |
| InChI | InChI=1S/C32H32N4O5/c1-40-30(38)28-27(29(37)33-19-20-34-31(39)36-24-15-9-4-10-16-24)25-17-18-32(28,41-25)26(21-22-11-5-2-6-12-22)35-23-13-7-3-8-14-23/h2-18,25-26,35H,19-21H2,1H3,(H,33,37)(H2,34,36,39) |
| InChIKey | DLUBNLGMFHSWNF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|