C25H22N2O5 — CID 153400317
dimethyl 1-[1-anilino-2-(4-cyanophenyl)ethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 153400317) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is dimethyl 1-[1-anilino-2-(4-cyanophenyl)ethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[1-anilino-2-(4-cyanophenyl)ethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 153400317 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | dimethyl 1-[1-anilino-2-(4-cyanophenyl)ethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C(Cc3ccc(C#N)cc3)Nc3ccccc3)C=CC1O2 |
| InChI | InChI=1S/C25H22N2O5/c1-30-23(28)21-19-12-13-25(32-19,22(21)24(29)31-2)20(27-18-6-4-3-5-7-18)14-16-8-10-17(15-26)11-9-16/h3-13,19-20,27H,14H2,1-2H3 |
| InChIKey | RWCOEWONBYQBGA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|