About methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate
methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate (PubChem CID 146331268) has the molecular formula C23H21NO5
and a molecular weight of 391.42 g/mol. Its IUPAC name is methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
| PubChem CID | 146331268 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
| SMILES | COC(=O)C1=C(C(N)=O)C2C=CC1(C(Cc1ccccc1)Oc1ccccc1)O2 |
| InChI | InChI=1S/C23H21NO5/c1-27-22(26)20-19(21(24)25)17-12-13-23(20,29-17)18(14-15-8-4-2-5-9-15)28-16-10-6-3-7-11-16/h2-13,17-18H,14H2,1H3,(H2,24,25) |
| InChIKey | KPJBIMODEBTMKM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate?
The IUPAC name of methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate (CID 146331268) is methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate.
What is the SMILES notation for methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate?
The canonical SMILES for methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate is COC(=O)C1=C(C(N)=O)C2C=CC1(C(Cc1ccccc1)Oc1ccccc1)O2.
What is the InChIKey of methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate?
The InChIKey is KPJBIMODEBTMKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO5/c1-27-22(26)20-19(21(24)25)17-12-13-23(20,29-17)18(14-15-8-4-2-5-9-15)28-16-10-6-3-7-11-16/h2-13,17-18H,14H2,1H3,(H2,24,25).
What are the key properties of methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate?
methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate has a molecular weight of 391.42 g/mol, XLogP of 2.34, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-carbamoyl-1-(1-phenoxy-2-phenylethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate is sourced from PubChem (CID 146331268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).