About 2-imidazo[1,2-a]pyrazin-2-yl-4,5-dihydro-1,3-thiazole
2-imidazo[1,2-a]pyrazin-2-yl-4,5-dihydro-1,3-thiazole (PubChem CID 146331606) has the molecular formula C9H8N4S
and a molecular weight of 204.26 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyrazin-2-yl-4,5-dihydro-1,3-thiazole.
Analyze 2-imidazo[1,2-a]pyrazin-2-yl-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazo[1,2-a]pyrazin-2-yl-4,5-dihydro-1,3-thiazole?
The IUPAC name of 2-imidazo[1,2-a]pyrazin-2-yl-4,5-dihydro-1,3-thiazole (CID 146331606) is 2-imidazo[1,2-a]pyrazin-2-yl-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for 2-imidazo[1,2-a]pyrazin-2-yl-4,5-dihydro-1,3-thiazole?
The canonical SMILES for 2-imidazo[1,2-a]pyrazin-2-yl-4,5-dihydro-1,3-thiazole is c1cn2cc(C3=NCCS3)nc2cn1.
What is the InChIKey of 2-imidazo[1,2-a]pyrazin-2-yl-4,5-dihydro-1,3-thiazole?
The InChIKey is KUPFMMSCZAKRKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4S/c1-3-13-6-7(9-11-2-4-14-9)12-8(13)5-10-1/h1,3,5-6H,2,4H2.
What are the key properties of 2-imidazo[1,2-a]pyrazin-2-yl-4,5-dihydro-1,3-thiazole?
2-imidazo[1,2-a]pyrazin-2-yl-4,5-dihydro-1,3-thiazole has a molecular weight of 204.26 g/mol, XLogP of 1.22, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[1,2-a]pyrazin-2-yl-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 146331606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).